C19H20F6N4O4S — CID 155837052
5-pyrimidin-2-yl-2-(thiophen-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155837052) has the molecular formula C19H20F6N4O4S and a molecular weight of 514.45 g/mol. Its IUPAC name is 5-pyrimidin-2-yl-2-(thiophen-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 5-pyrimidin-2-yl-2-(thiophen-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155837052 |
| Molecular Formula | C19H20F6N4O4S |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 5-pyrimidin-2-yl-2-(thiophen-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cnc(N2CC3CN(Cc4ccsc4)CC3C2)nc1 |
| InChI | InChI=1S/C15H18N4S.2C2HF3O2/c1-3-16-15(17-4-1)19-9-13-7-18(8-14(13)10-19)6-12-2-5-20-11-12;2*3-2(4,5)1(6)7/h1-5,11,13-14H,6-10H2;2*(H,6,7) |
| InChIKey | BDAVLLFAKQVPMO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |