C18H22F4N4O5 — CID 155840087
2-[(2R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-morpholin-4-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155840087) has the molecular formula C18H22F4N4O5 and a molecular weight of 450.39 g/mol. Its IUPAC name is 2-[(2R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-morpholin-4-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(2R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-morpholin-4-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155840087 |
| Molecular Formula | C18H22F4N4O5 |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-[(2R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-morpholin-4-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C[C@H]1C[C@H]2CN(c3ncc(F)cn3)C[C@H]2O1)N1CCOCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21FN4O3.C2HF3O2/c17-12-7-18-16(19-8-12)21-9-11-5-13(24-14(11)10-21)6-15(22)20-1-3-23-4-2-20;3-2(4,5)1(6)7/h7-8,11,13-14H,1-6,9-10H2;(H,6,7)/t11-,13+,14+;/m0./s1 |
| InChIKey | QGDSUZYPVURHBQ-IRIHETDOSA-N |
| XLogP | 1.09 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |