C17H20F4N4O5 — CID 155840320
[(3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-(1,2-oxazolidin-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155840320) has the molecular formula C17H20F4N4O5 and a molecular weight of 436.36 g/mol. Its IUPAC name is [(3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-(1,2-oxazolidin-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-(1,2-oxazolidin-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155840320 |
| Molecular Formula | C17H20F4N4O5 |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | [(3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-(1,2-oxazolidin-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(N1CCCO1)[C@@]12CCO[C@@H]1CCN(c1ncc(F)cn1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H19FN4O3.C2HF3O2/c16-11-8-17-14(18-9-11)19-5-2-12-15(10-19,3-7-22-12)13(21)20-4-1-6-23-20;3-2(4,5)1(6)7/h8-9,12H,1-7,10H2;(H,6,7)/t12-,15-;/m1./s1 |
| InChIKey | OGGHRAQYVQLUCR-XRZFDKQNSA-N |
| XLogP | 1.40 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |