C14H24Cl3N3O — CID 155844063
(4R,4aS,7aS)-4-methoxy-6-(pyridin-3-ylmethyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine;trihydrochloride (PubChem CID 155844063) has the molecular formula C14H24Cl3N3O and a molecular weight of 356.73 g/mol. Its IUPAC name is (4R,4aS,7aS)-4-methoxy-6-(pyridin-3-ylmethyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine;trihydrochloride.
| Compound Name | (4R,4aS,7aS)-4-methoxy-6-(pyridin-3-ylmethyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine;trihydrochloride |
|---|---|
| PubChem CID | 155844063 |
| Molecular Formula | C14H24Cl3N3O |
| Molecular Weight | 356.73 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (4R,4aS,7aS)-4-methoxy-6-(pyridin-3-ylmethyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine;trihydrochloride |
| SMILES | CO[C@@H]1CCN[C@@H]2CN(Cc3cccnc3)C[C@@H]21.Cl.Cl.Cl |
| InChI | InChI=1S/C14H21N3O.3ClH/c1-18-14-4-6-16-13-10-17(9-12(13)14)8-11-3-2-5-15-7-11;;;/h2-3,5,7,12-14,16H,4,6,8-10H2,1H3;3*1H/t12-,13+,14+;;;/m0.../s1 |
| InChIKey | CKJHINZTQUNEFL-JNFDPCJISA-N |
| XLogP | 2.16 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.73 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |