C19H26F3N3O4 — CID 155845447
3-(diethylamino)-N-(3-methoxypropyl)indolizine-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155845447) has the molecular formula C19H26F3N3O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is 3-(diethylamino)-N-(3-methoxypropyl)indolizine-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(diethylamino)-N-(3-methoxypropyl)indolizine-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155845447 |
| Molecular Formula | C19H26F3N3O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 3-(diethylamino)-N-(3-methoxypropyl)indolizine-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)c1ccc2ccc(C(=O)NCCCOC)cn12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O2.C2HF3O2/c1-4-19(5-2)16-10-9-15-8-7-14(13-20(15)16)17(21)18-11-6-12-22-3;3-2(4,5)1(6)7/h7-10,13H,4-6,11-12H2,1-3H3,(H,18,21);(H,6,7) |
| InChIKey | ZWDGUUZKCCZFHD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|