C18H19F3N4O4S — CID 155846212
(5aR,9aR)-8-pyrimidin-2-yl-4-thiophen-3-yl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155846212) has the molecular formula C18H19F3N4O4S and a molecular weight of 444.44 g/mol. Its IUPAC name is (5aR,9aR)-8-pyrimidin-2-yl-4-thiophen-3-yl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (5aR,9aR)-8-pyrimidin-2-yl-4-thiophen-3-yl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155846212 |
| Molecular Formula | C18H19F3N4O4S |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (5aR,9aR)-8-pyrimidin-2-yl-4-thiophen-3-yl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1[C@@H]2CCN(c3ncccn3)C[C@@H]2OCCN1c1ccsc1 |
| InChI | InChI=1S/C16H18N4O2S.C2HF3O2/c21-15-13-2-6-19(16-17-4-1-5-18-16)10-14(13)22-8-7-20(15)12-3-9-23-11-12;3-2(4,5)1(6)7/h1,3-5,9,11,13-14H,2,6-8,10H2;(H,6,7)/t13-,14+;/m1./s1 |
| InChIKey | OEJCFNRBENIGRH-DFQHDRSWSA-N |
| XLogP | 2.43 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |