C18H21N3O2S — CID 125249013
(5aS,9aS)-8-(pyridin-2-ylmethyl)-4-thiophen-3-yl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one (PubChem CID 125249013) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is (5aS,9aS)-8-(pyridin-2-ylmethyl)-4-thiophen-3-yl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one.
| Compound Name | (5aS,9aS)-8-(pyridin-2-ylmethyl)-4-thiophen-3-yl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 125249013 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (5aS,9aS)-8-(pyridin-2-ylmethyl)-4-thiophen-3-yl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one |
| SMILES | O=C1[C@H]2CCN(Cc3ccccn3)C[C@H]2OCCN1c1ccsc1 |
| InChI | InChI=1S/C18H21N3O2S/c22-18-16-4-7-20(11-14-3-1-2-6-19-14)12-17(16)23-9-8-21(18)15-5-10-24-13-15/h1-3,5-6,10,13,16-17H,4,7-9,11-12H2/t16-,17+/m0/s1 |
| InChIKey | OOPNCTCNUCLXSK-DLBZAZTESA-N |
| XLogP | 2.40 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |