C20H27F3N4O4S — CID 155846359
13-acetyl-3-methyl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;2,2,2-trifluoroacetic acid (PubChem CID 155846359) has the molecular formula C20H27F3N4O4S and a molecular weight of 476.52 g/mol. Its IUPAC name is 13-acetyl-3-methyl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | 13-acetyl-3-methyl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155846359 |
| Molecular Formula | C20H27F3N4O4S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 13-acetyl-3-methyl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)N1CC2(CCN(Cc3nccs3)CC2)C2(CCN(C)C2=O)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N4O2S.C2HF3O2/c1-14(23)22-12-17(18(13-22)5-7-20(2)16(18)24)3-8-21(9-4-17)11-15-19-6-10-25-15;3-2(4,5)1(6)7/h6,10H,3-5,7-9,11-13H2,1-2H3;(H,6,7) |
| InChIKey | PVQSBORZGIXMNT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |