C20H29F3N4O5S2 — CID 155824415
3-ethyl-13-methylsulfonyl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;2,2,2-trifluoroacetic acid (PubChem CID 155824415) has the molecular formula C20H29F3N4O5S2 and a molecular weight of 526.60 g/mol. Its IUPAC name is 3-ethyl-13-methylsulfonyl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | 3-ethyl-13-methylsulfonyl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155824415 |
| Molecular Formula | C20H29F3N4O5S2 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | 3-ethyl-13-methylsulfonyl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CCC2(CN(S(C)(=O)=O)CC23CCN(Cc2nccs2)CC3)C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N4O3S2.C2HF3O2/c1-3-21-10-6-18(16(21)23)14-22(27(2,24)25)13-17(18)4-8-20(9-5-17)12-15-19-7-11-26-15;3-2(4,5)1(6)7/h7,11H,3-6,8-10,12-14H2,1-2H3;(H,6,7) |
| InChIKey | RPXIDYHLPSVUKV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |