C21H29F3N4O4S — CID 155852199
13-acetyl-3-ethyl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;2,2,2-trifluoroacetic acid (PubChem CID 155852199) has the molecular formula C21H29F3N4O4S and a molecular weight of 490.55 g/mol. Its IUPAC name is 13-acetyl-3-ethyl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | 13-acetyl-3-ethyl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155852199 |
| Molecular Formula | C21H29F3N4O4S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 13-acetyl-3-ethyl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CCC2(CN(C(C)=O)CC23CCN(Cc2nccs2)CC3)C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H28N4O2S.C2HF3O2/c1-3-22-10-6-19(17(22)25)14-23(15(2)24)13-18(19)4-8-21(9-5-18)12-16-20-7-11-26-16;3-2(4,5)1(6)7/h7,11H,3-6,8-10,12-14H2,1-2H3;(H,6,7) |
| InChIKey | MMZBQXDFTFSABY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |