C24H34F6N4O6S — CID 155831865
3-ethyl-13-(2-methoxyethyl)-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155831865) has the molecular formula C24H34F6N4O6S and a molecular weight of 620.61 g/mol. Its IUPAC name is 3-ethyl-13-(2-methoxyethyl)-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-ethyl-13-(2-methoxyethyl)-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155831865 |
| Molecular Formula | C24H34F6N4O6S |
| Molecular Weight | 620.61 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | 3-ethyl-13-(2-methoxyethyl)-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN1CCC2(CN(CCOC)CC23CCN(Cc2nccs2)CC3)C1=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H32N4O2S.2C2HF3O2/c1-3-24-10-6-20(18(24)25)16-23(11-12-26-2)15-19(20)4-8-22(9-5-19)14-17-21-7-13-27-17;2*3-2(4,5)1(6)7/h7,13H,3-6,8-12,14-16H2,1-2H3;2*(H,6,7) |
| InChIKey | BRGZDMLPXARVDB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |