C18H22F6N6O5 — CID 155848991
1-methyl-N-[(7-methyl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl)methyl]imidazole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155848991) has the molecular formula C18H22F6N6O5 and a molecular weight of 516.40 g/mol. Its IUPAC name is 1-methyl-N-[(7-methyl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl)methyl]imidazole-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-methyl-N-[(7-methyl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl)methyl]imidazole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155848991 |
| Molecular Formula | C18H22F6N6O5 |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 1-methyl-N-[(7-methyl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl)methyl]imidazole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1CCc2ncc(CNC(=O)c3nccn3C)n2CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H20N6O.2C2HF3O2/c1-18-5-3-12-16-9-11(20(12)8-7-18)10-17-14(21)13-15-4-6-19(13)2;2*3-2(4,5)1(6)7/h4,6,9H,3,5,7-8,10H2,1-2H3,(H,17,21);2*(H,6,7) |
| InChIKey | OYQRCKCNXRIVHR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |