C17H20F6N6O5 — CID 171685926
1-methyl-N-(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-3-ylmethyl)imidazole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171685926) has the molecular formula C17H20F6N6O5 and a molecular weight of 502.37 g/mol. Its IUPAC name is 1-methyl-N-(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-3-ylmethyl)imidazole-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-methyl-N-(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-3-ylmethyl)imidazole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171685926 |
| Molecular Formula | C17H20F6N6O5 |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 1-methyl-N-(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-3-ylmethyl)imidazole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1ccnc1C(=O)NCc1cnc2n1CCNCC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H18N6O.2C2HF3O2/c1-18-6-5-15-12(18)13(20)17-9-10-8-16-11-2-3-14-4-7-19(10)11;2*3-2(4,5)1(6)7/h5-6,8,14H,2-4,7,9H2,1H3,(H,17,20);2*(H,6,7) |
| InChIKey | VCDWOEFABAHZOL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 151.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |