C19H22F6N4O4S2 — CID 155849488
2-methyl-4-[[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.4]octan-7-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155849488) has the molecular formula C19H22F6N4O4S2 and a molecular weight of 548.53 g/mol. Its IUPAC name is 2-methyl-4-[[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.4]octan-7-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-methyl-4-[[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.4]octan-7-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155849488 |
| Molecular Formula | C19H22F6N4O4S2 |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | 2-methyl-4-[[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.4]octan-7-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2CCC3(C2)CN(Cc2nccs2)C3)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H20N4S2.2C2HF3O2/c1-12-17-13(8-21-12)6-18-4-2-15(9-18)10-19(11-15)7-14-16-3-5-20-14;2*3-2(4,5)1(6)7/h3,5,8H,2,4,6-7,9-11H2,1H3;2*(H,6,7) |
| InChIKey | LIQSVGZSDRUGQS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |