C18H21F3N4O3S2 — CID 155836820
2-[(2-methyl-1,3-thiazol-4-yl)methyl]-7-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-3-one;2,2,2-trifluoroacetic acid (PubChem CID 155836820) has the molecular formula C18H21F3N4O3S2 and a molecular weight of 462.52 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-7-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-7-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155836820 |
| Molecular Formula | C18H21F3N4O3S2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-7-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-3-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CC3(CCN(Cc4nccs4)C3)CC2=O)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H20N4OS2.C2HF3O2/c1-12-18-13(9-23-12)7-20-11-16(6-15(20)21)2-4-19(10-16)8-14-17-3-5-22-14;3-2(4,5)1(6)7/h3,5,9H,2,4,6-8,10-11H2,1H3;(H,6,7) |
| InChIKey | HQUXVFHDJCJUMT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |