C21H27F3N4O3S2 — CID 155868121
1-[(2-methyl-1,3-thiazol-4-yl)methyl]-9-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 155868121) has the molecular formula C21H27F3N4O3S2 and a molecular weight of 504.60 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-9-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-9-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155868121 |
| Molecular Formula | C21H27F3N4O3S2 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-9-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2C(=O)CCC23CCCN(Cc2cnc(C)s2)CC3)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H26N4OS2.C2HF3O2/c1-14-20-10-17(26-14)12-22-8-3-5-19(7-9-22)6-4-18(24)23(19)11-16-13-25-15(2)21-16;3-2(4,5)1(6)7/h10,13H,3-9,11-12H2,1-2H3;(H,6,7) |
| InChIKey | IYSFMDOUFLYYJU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |