C20H29F3N4O5 — CID 155851346
2-cyclopentyl-1-[3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155851346) has the molecular formula C20H29F3N4O5 and a molecular weight of 462.47 g/mol. Its IUPAC name is 2-cyclopentyl-1-[3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-cyclopentyl-1-[3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155851346 |
| Molecular Formula | C20H29F3N4O5 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 2-cyclopentyl-1-[3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]ethanone;2,2,2-trifluoroacetic acid |
| SMILES | COCCNc1ccnc(C2COCCN2C(=O)CC2CCCC2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N4O3.C2HF3O2/c1-24-10-8-19-16-6-7-20-18(21-16)15-13-25-11-9-22(15)17(23)12-14-4-2-3-5-14;3-2(4,5)1(6)7/h6-7,14-15H,2-5,8-13H2,1H3,(H,19,20,21);(H,6,7) |
| InChIKey | XASBLVVQLHWXEC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|