C20H27F3N4O5 — CID 155825836
cyclohexen-1-yl-[3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 155825836) has the molecular formula C20H27F3N4O5 and a molecular weight of 460.45 g/mol. Its IUPAC name is cyclohexen-1-yl-[3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | cyclohexen-1-yl-[3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155825836 |
| Molecular Formula | C20H27F3N4O5 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | cyclohexen-1-yl-[3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | COCCNc1ccnc(C2COCCN2C(=O)C2=CCCCC2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N4O3.C2HF3O2/c1-24-11-9-19-16-7-8-20-17(21-16)15-13-25-12-10-22(15)18(23)14-5-3-2-4-6-14;3-2(4,5)1(6)7/h5,7-8,15H,2-4,6,9-13H2,1H3,(H,19,20,21);(H,6,7) |
| InChIKey | OUJXBCLMDKFWDN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|