C22H29F3N4O4 — CID 155836113
2-(cyclohexen-1-yl)-1-[3-(4-pyrrolidin-1-ylpyrimidin-2-yl)morpholin-4-yl]ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155836113) has the molecular formula C22H29F3N4O4 and a molecular weight of 470.49 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-[3-(4-pyrrolidin-1-ylpyrimidin-2-yl)morpholin-4-yl]ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(cyclohexen-1-yl)-1-[3-(4-pyrrolidin-1-ylpyrimidin-2-yl)morpholin-4-yl]ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155836113 |
| Molecular Formula | C22H29F3N4O4 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-[3-(4-pyrrolidin-1-ylpyrimidin-2-yl)morpholin-4-yl]ethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CC1=CCCCC1)N1CCOCC1c1nccc(N2CCCC2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28N4O2.C2HF3O2/c25-19(14-16-6-2-1-3-7-16)24-12-13-26-15-17(24)20-21-9-8-18(22-20)23-10-4-5-11-23;3-2(4,5)1(6)7/h6,8-9,17H,1-5,7,10-15H2;(H,6,7) |
| InChIKey | JLHLNHOAXXHYJS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|