C22H29F3N4O4 — CID 155861610
1-[3-[4-(cyclobutylamino)pyrimidin-2-yl]morpholin-4-yl]-2-(cyclohexen-1-yl)ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155861610) has the molecular formula C22H29F3N4O4 and a molecular weight of 470.49 g/mol. Its IUPAC name is 1-[3-[4-(cyclobutylamino)pyrimidin-2-yl]morpholin-4-yl]-2-(cyclohexen-1-yl)ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[3-[4-(cyclobutylamino)pyrimidin-2-yl]morpholin-4-yl]-2-(cyclohexen-1-yl)ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155861610 |
| Molecular Formula | C22H29F3N4O4 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 1-[3-[4-(cyclobutylamino)pyrimidin-2-yl]morpholin-4-yl]-2-(cyclohexen-1-yl)ethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CC1=CCCCC1)N1CCOCC1c1nccc(NC2CCC2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28N4O2.C2HF3O2/c25-19(13-15-5-2-1-3-6-15)24-11-12-26-14-17(24)20-21-10-9-18(23-20)22-16-7-4-8-16;3-2(4,5)1(6)7/h5,9-10,16-17H,1-4,6-8,11-14H2,(H,21,22,23);(H,6,7) |
| InChIKey | HVRZYUDJYUFXPP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|