C26H28F3N5O2S — CID 155851601
N,N-dimethyl-4-[[4-(6-thiophen-2-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)piperidin-1-yl]methyl]aniline;2,2,2-trifluoroacetic acid (PubChem CID 155851601) has the molecular formula C26H28F3N5O2S and a molecular weight of 531.60 g/mol. Its IUPAC name is N,N-dimethyl-4-[[4-(6-thiophen-2-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)piperidin-1-yl]methyl]aniline;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-4-[[4-(6-thiophen-2-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)piperidin-1-yl]methyl]aniline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155851601 |
| Molecular Formula | C26H28F3N5O2S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | N,N-dimethyl-4-[[4-(6-thiophen-2-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)piperidin-1-yl]methyl]aniline;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)c1ccc(CN2CCC(c3nc4ccc(-c5cccs5)cn4n3)CC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H27N5S.C2HF3O2/c1-27(2)21-8-5-18(6-9-21)16-28-13-11-19(12-14-28)24-25-23-10-7-20(17-29(23)26-24)22-4-3-15-30-22;3-2(4,5)1(6)7/h3-10,15,17,19H,11-14,16H2,1-2H3;(H,6,7) |
| InChIKey | YQIKANURCNJPJA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|