C20H28F6N4O7 — CID 155851707
(4R,4aS,7aS)-4-methoxy-6-(2-methoxyethyl)-1-(6-methoxypyrimidin-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155851707) has the molecular formula C20H28F6N4O7 and a molecular weight of 550.45 g/mol. Its IUPAC name is (4R,4aS,7aS)-4-methoxy-6-(2-methoxyethyl)-1-(6-methoxypyrimidin-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4R,4aS,7aS)-4-methoxy-6-(2-methoxyethyl)-1-(6-methoxypyrimidin-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155851707 |
| Molecular Formula | C20H28F6N4O7 |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | (4R,4aS,7aS)-4-methoxy-6-(2-methoxyethyl)-1-(6-methoxypyrimidin-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCN1C[C@H]2[C@@H](C1)N(c1cc(OC)ncn1)CC[C@H]2OC.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H26N4O3.2C2HF3O2/c1-21-7-6-19-9-12-13(10-19)20(5-4-14(12)22-2)15-8-16(23-3)18-11-17-15;2*3-2(4,5)1(6)7/h8,11-14H,4-7,9-10H2,1-3H3;2*(H,6,7)/t12-,13+,14+;;/m0../s1 |
| InChIKey | FYCLKFQWOOSBDO-BCIMQBNMSA-N |
| XLogP | 1.92 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |