C12H21ClN2O3 — CID 155851899
[(3aR,5S,7aR)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrol-5-yl]-(oxazinan-2-yl)methanone;hydrochloride (PubChem CID 155851899) has the molecular formula C12H21ClN2O3 and a molecular weight of 276.76 g/mol. Its IUPAC name is [(3aR,5S,7aR)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrol-5-yl]-(oxazinan-2-yl)methanone;hydrochloride.
| Compound Name | [(3aR,5S,7aR)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrol-5-yl]-(oxazinan-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 155851899 |
| Molecular Formula | C12H21ClN2O3 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | [(3aR,5S,7aR)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrol-5-yl]-(oxazinan-2-yl)methanone;hydrochloride |
| SMILES | Cl.O=C([C@@H]1CC[C@H]2NCC[C@H]2O1)N1CCCCO1 |
| InChI | InChI=1S/C12H20N2O3.ClH/c15-12(14-7-1-2-8-16-14)11-4-3-9-10(17-11)5-6-13-9;/h9-11,13H,1-8H2;1H/t9-,10-,11+;/m1./s1 |
| InChIKey | NLPJKEUHYGQGNO-NQHCQCOHSA-N |
| XLogP | 0.87 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |