C24H28N4O6 — CID 15585624
1,4-dihydroxy-5,8-bis[2-(1,3-oxazolidin-3-yl)ethylamino]anthracene-9,10-dione (PubChem CID 15585624) has the molecular formula C24H28N4O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is 1,4-dihydroxy-5,8-bis[2-(1,3-oxazolidin-3-yl)ethylamino]anthracene-9,10-dione.
| Compound Name | 1,4-dihydroxy-5,8-bis[2-(1,3-oxazolidin-3-yl)ethylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 15585624 |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 1,4-dihydroxy-5,8-bis[2-(1,3-oxazolidin-3-yl)ethylamino]anthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc(O)c2C(=O)c2c(NCCN3CCOC3)ccc(NCCN3CCOC3)c21 |
| InChI | InChI=1S/C24H28N4O6/c29-17-3-4-18(30)22-21(17)23(31)19-15(25-5-7-27-9-11-33-13-27)1-2-16(20(19)24(22)32)26-6-8-28-10-12-34-14-28/h1-4,25-26,29-30H,5-14H2 |
| InChIKey | IGCZIQBVQVLKKZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|