C19H22F5N5O3S — CID 155856742
[10,10-difluoro-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,7-diazaspiro[4.5]decan-7-yl]-(1H-pyrazol-5-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155856742) has the molecular formula C19H22F5N5O3S and a molecular weight of 495.47 g/mol. Its IUPAC name is [10,10-difluoro-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,7-diazaspiro[4.5]decan-7-yl]-(1H-pyrazol-5-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [10,10-difluoro-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,7-diazaspiro[4.5]decan-7-yl]-(1H-pyrazol-5-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155856742 |
| Molecular Formula | C19H22F5N5O3S |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | [10,10-difluoro-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,7-diazaspiro[4.5]decan-7-yl]-(1H-pyrazol-5-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CCC3(C2)CN(C(=O)c2ccn[nH]2)CCC3(F)F)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H21F2N5OS.C2HF3O2/c1-12-21-13(9-26-12)8-23-6-3-16(10-23)11-24(7-4-17(16,18)19)15(25)14-2-5-20-22-14;3-2(4,5)1(6)7/h2,5,9H,3-4,6-8,10-11H2,1H3,(H,20,22);(H,6,7) |
| InChIKey | YEJVTCGQVUUVSD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |