C15H19N5OS — CID 131681695
[2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 131681695) has the molecular formula C15H19N5OS and a molecular weight of 317.42 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 131681695 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | Cc1nc(CN2CC3CN(C(=O)c4ccn[nH]4)CC3C2)cs1 |
| InChI | InChI=1S/C15H19N5OS/c1-10-17-13(9-22-10)8-19-4-11-6-20(7-12(11)5-19)15(21)14-2-3-16-18-14/h2-3,9,11-12H,4-8H2,1H3,(H,16,18) |
| InChIKey | YRPWAPUPGSDRGY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |