C18H22N4O2S — CID 131681838
(5-cyclopropyl-1,2-oxazol-3-yl)-[2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 131681838) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is (5-cyclopropyl-1,2-oxazol-3-yl)-[2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (5-cyclopropyl-1,2-oxazol-3-yl)-[2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 131681838 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (5-cyclopropyl-1,2-oxazol-3-yl)-[2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Cc1nc(CN2CC3CN(C(=O)c4cc(C5CC5)on4)CC3C2)cs1 |
| InChI | InChI=1S/C18H22N4O2S/c1-11-19-15(10-25-11)9-21-5-13-7-22(8-14(13)6-21)18(23)16-4-17(24-20-16)12-2-3-12/h4,10,12-14H,2-3,5-9H2,1H3 |
| InChIKey | MWVPQJLURJIQRC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |