C18H25F3N4O5 — CID 155857085
2-(dimethylamino)-1-[7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155857085) has the molecular formula C18H25F3N4O5 and a molecular weight of 434.42 g/mol. Its IUPAC name is 2-(dimethylamino)-1-[7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(dimethylamino)-1-[7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155857085 |
| Molecular Formula | C18H25F3N4O5 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-(dimethylamino)-1-[7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]ethanone;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CC(=O)N1CCOC2C(COc3ncccn3)CCC21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4O3.C2HF3O2/c1-19(2)10-14(21)20-8-9-22-15-12(4-5-13(15)20)11-23-16-17-6-3-7-18-16;3-2(4,5)1(6)7/h3,6-7,12-13,15H,4-5,8-11H2,1-2H3;(H,6,7) |
| InChIKey | LDWHHEYRIMPBOM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |