C18H24F3N3O4 — CID 155829038
4-(cyclopropylmethyl)-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 155829038) has the molecular formula C18H24F3N3O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(cyclopropylmethyl)-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829038 |
| Molecular Formula | C18H24F3N3O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 4-(cyclopropylmethyl)-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1cnc(OCC2CCC3C2OCCN3CC2CC2)nc1 |
| InChI | InChI=1S/C16H23N3O2.C2HF3O2/c1-6-17-16(18-7-1)21-11-13-4-5-14-15(13)20-9-8-19(14)10-12-2-3-12;3-2(4,5)1(6)7/h1,6-7,12-15H,2-5,8-11H2;(H,6,7) |
| InChIKey | SGFRAMYRXPYGDY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |