C14H18F3N3O4 — CID 155829160
(4aS,7R,7aR)-7-methoxy-4-pyrimidin-2-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 155829160) has the molecular formula C14H18F3N3O4 and a molecular weight of 349.31 g/mol. Its IUPAC name is (4aS,7R,7aR)-7-methoxy-4-pyrimidin-2-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,7R,7aR)-7-methoxy-4-pyrimidin-2-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829160 |
| Molecular Formula | C14H18F3N3O4 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (4aS,7R,7aR)-7-methoxy-4-pyrimidin-2-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@@H]1CC[C@H]2[C@H]1OCCN2c1ncccn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H17N3O2.C2HF3O2/c1-16-10-4-3-9-11(10)17-8-7-15(9)12-13-5-2-6-14-12;3-2(4,5)1(6)7/h2,5-6,9-11H,3-4,7-8H2,1H3;(H,6,7)/t9-,10+,11+;/m0./s1 |
| InChIKey | IPIWUTSJEADEJZ-RIAUZDOBSA-N |
| XLogP | 1.49 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |