C16H20F3N3O6 — CID 155827922
2-[7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 155827922) has the molecular formula C16H20F3N3O6 and a molecular weight of 407.35 g/mol. Its IUPAC name is 2-[7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827922 |
| Molecular Formula | C16H20F3N3O6 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-[7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CN1CCOC2C(COc3ncccn3)CCC21 |
| InChI | InChI=1S/C14H19N3O4.C2HF3O2/c18-12(19)8-17-6-7-20-13-10(2-3-11(13)17)9-21-14-15-4-1-5-16-14;3-2(4,5)1(6)7/h1,4-5,10-11,13H,2-3,6-9H2,(H,18,19);(H,6,7) |
| InChIKey | URAKQNMQKUSKKJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |