C18H21F6N3O5S — CID 155857372
1-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155857372) has the molecular formula C18H21F6N3O5S and a molecular weight of 505.44 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155857372 |
| Molecular Formula | C18H21F6N3O5S |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C=CCN1C(=O)CC2C1CCN2Cc1csc(C)n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19N3OS.2C2HF3O2/c1-3-5-17-12-4-6-16(13(12)7-14(17)18)8-11-9-19-10(2)15-11;2*3-2(4,5)1(6)7/h3,9,12-13H,1,4-8H2,2H3;2*(H,6,7) |
| InChIKey | VLBHWPWPKRQLFF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|