C22H21F6N3O5 — CID 155857519
N-[(3aR,4R,8bR)-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrol-4-yl]-4-aminobenzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155857519) has the molecular formula C22H21F6N3O5 and a molecular weight of 521.41 g/mol. Its IUPAC name is N-[(3aR,4R,8bR)-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrol-4-yl]-4-aminobenzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[(3aR,4R,8bR)-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrol-4-yl]-4-aminobenzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155857519 |
| Molecular Formula | C22H21F6N3O5 |
| Molecular Weight | 521.41 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | N-[(3aR,4R,8bR)-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrol-4-yl]-4-aminobenzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Nc1ccc(C(=O)N[C@H]2c3ccccc3[C@@H]3CNC[C@@H]32)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H19N3O.2C2HF3O2/c19-12-7-5-11(6-8-12)18(22)21-17-14-4-2-1-3-13(14)15-9-20-10-16(15)17;2*3-2(4,5)1(6)7/h1-8,15-17,20H,9-10,19H2,(H,21,22);2*(H,6,7)/t15-,16-,17-;;/m0../s1 |
| InChIKey | JZWLBOODYPWADB-ZQGHYHNTSA-N |
| XLogP | 3.32 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|