C26H23F3N2O3 — CID 155851399
N-[(3aR,4S,8bR)-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrol-4-yl]-4-phenylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 155851399) has the molecular formula C26H23F3N2O3 and a molecular weight of 468.48 g/mol. Its IUPAC name is N-[(3aR,4S,8bR)-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrol-4-yl]-4-phenylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3aR,4S,8bR)-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrol-4-yl]-4-phenylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155851399 |
| Molecular Formula | C26H23F3N2O3 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-[(3aR,4S,8bR)-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrol-4-yl]-4-phenylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(N[C@@H]1c2ccccc2[C@@H]2CNC[C@H]12)c1ccc(-c2ccccc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H22N2O.C2HF3O2/c27-24(18-12-10-17(11-13-18)16-6-2-1-3-7-16)26-23-20-9-5-4-8-19(20)21-14-25-15-22(21)23;3-2(4,5)1(6)7/h1-13,21-23,25H,14-15H2,(H,26,27);(H,6,7)/t21-,22-,23+;/m0./s1 |
| InChIKey | CLFASNWZNSKJSA-WYDYMJQDSA-N |
| XLogP | 4.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |