C16H17F3N4O3S2 — CID 155859268
[(3aS,6aR)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155859268) has the molecular formula C16H17F3N4O3S2 and a molecular weight of 434.47 g/mol. Its IUPAC name is [(3aS,6aR)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aS,6aR)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155859268 |
| Molecular Formula | C16H17F3N4O3S2 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | [(3aS,6aR)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1cscn1)N1CC[C@@H]2[C@@H]1CCN2Cc1nccs1 |
| InChI | InChI=1S/C14H16N4OS2.C2HF3O2/c19-14(10-8-20-9-16-10)18-5-2-11-12(18)1-4-17(11)7-13-15-3-6-21-13;3-2(4,5)1(6)7/h3,6,8-9,11-12H,1-2,4-5,7H2;(H,6,7)/t11-,12+;/m1./s1 |
| InChIKey | LQOZFFUFOKCPEH-LYCTWNKOSA-N |
| XLogP | 2.72 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |