C19H27F6N3O6S — CID 155869154
(5aR,9aS)-4-(2-methoxyethyl)-8-(1,3-thiazol-2-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155869154) has the molecular formula C19H27F6N3O6S and a molecular weight of 539.50 g/mol. Its IUPAC name is (5aR,9aS)-4-(2-methoxyethyl)-8-(1,3-thiazol-2-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (5aR,9aS)-4-(2-methoxyethyl)-8-(1,3-thiazol-2-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155869154 |
| Molecular Formula | C19H27F6N3O6S |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | (5aR,9aS)-4-(2-methoxyethyl)-8-(1,3-thiazol-2-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCN1CCO[C@@H]2CN(Cc3nccs3)CC[C@@H]2C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N3O2S.2C2HF3O2/c1-19-7-5-17-6-8-20-14-11-18(4-2-13(14)10-17)12-15-16-3-9-21-15;2*3-2(4,5)1(6)7/h3,9,13-14H,2,4-8,10-12H2,1H3;2*(H,6,7)/t13-,14-;;/m1../s1 |
| InChIKey | SFAUYCGQWUYTIL-KFWOVWKUSA-N |
| XLogP | 2.58 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |