C20H26F3N3O5S — CID 155869816
[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]-[4-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 155869816) has the molecular formula C20H26F3N3O5S and a molecular weight of 477.51 g/mol. Its IUPAC name is [(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]-[4-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]-[4-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155869816 |
| Molecular Formula | C20H26F3N3O5S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | [(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]-[4-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C1[C@H]2COC[C@@H]12)N1CCC2(CC1)CN(Cc1nccs1)CCO2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25N3O3S.C2HF3O2/c22-17(16-13-10-23-11-14(13)16)21-4-1-18(2-5-21)12-20(6-7-24-18)9-15-19-3-8-25-15;3-2(4,5)1(6)7/h3,8,13-14,16H,1-2,4-7,9-12H2;(H,6,7)/t13-,14+,16?; |
| InChIKey | JUZYVALEXYUXNM-DNCNHEBUSA-N |
| XLogP | 1.86 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |