C18H24F3N3O4S — CID 155838106
(5aR,9aR)-4-(cyclopropylmethyl)-8-(1,3-thiazol-2-ylmethyl)-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155838106) has the molecular formula C18H24F3N3O4S and a molecular weight of 435.47 g/mol. Its IUPAC name is (5aR,9aR)-4-(cyclopropylmethyl)-8-(1,3-thiazol-2-ylmethyl)-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (5aR,9aR)-4-(cyclopropylmethyl)-8-(1,3-thiazol-2-ylmethyl)-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155838106 |
| Molecular Formula | C18H24F3N3O4S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (5aR,9aR)-4-(cyclopropylmethyl)-8-(1,3-thiazol-2-ylmethyl)-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1[C@@H]2CCN(Cc3nccs3)C[C@@H]2OCCN1CC1CC1 |
| InChI | InChI=1S/C16H23N3O2S.C2HF3O2/c20-16-13-3-5-18(11-15-17-4-8-22-15)10-14(13)21-7-6-19(16)9-12-1-2-12;3-2(4,5)1(6)7/h4,8,12-14H,1-3,5-7,9-11H2;(H,6,7)/t13-,14+;/m1./s1 |
| InChIKey | GHGLXOIRCSHJTD-DFQHDRSWSA-N |
| XLogP | 2.24 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |