C12H17N3O2S — CID 97419281
(5aR,9aR)-8-(1,3-thiazol-2-ylmethyl)-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one (PubChem CID 97419281) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is (5aR,9aR)-8-(1,3-thiazol-2-ylmethyl)-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one.
| Compound Name | (5aR,9aR)-8-(1,3-thiazol-2-ylmethyl)-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 97419281 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (5aR,9aR)-8-(1,3-thiazol-2-ylmethyl)-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one |
| SMILES | O=C1NCCO[C@H]2CN(Cc3nccs3)CC[C@@H]12 |
| InChI | InChI=1S/C12H17N3O2S/c16-12-9-1-4-15(8-11-13-3-6-18-11)7-10(9)17-5-2-14-12/h3,6,9-10H,1-2,4-5,7-8H2,(H,14,16)/t9-,10+/m1/s1 |
| InChIKey | XZFTXDHZZDBMRP-ZJUUUORDSA-N |
| XLogP | 0.48 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |