C20H25F4N3O4 — CID 155869986
5-[2-(dimethylamino)ethyl]-2-[2-(3-fluorophenyl)acetyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid (PubChem CID 155869986) has the molecular formula C20H25F4N3O4 and a molecular weight of 447.43 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethyl]-2-[2-(3-fluorophenyl)acetyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[2-(dimethylamino)ethyl]-2-[2-(3-fluorophenyl)acetyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155869986 |
| Molecular Formula | C20H25F4N3O4 |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 5-[2-(dimethylamino)ethyl]-2-[2-(3-fluorophenyl)acetyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCN1CC2CN(C(=O)Cc3cccc(F)c3)CC2C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24FN3O2.C2HF3O2/c1-20(2)6-7-21-10-14-11-22(12-16(14)18(21)24)17(23)9-13-4-3-5-15(19)8-13;3-2(4,5)1(6)7/h3-5,8,14,16H,6-7,9-12H2,1-2H3;(H,6,7) |
| InChIKey | RJJZHIFDCFKRCD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |