C18H24N6O6 — CID 155870490
1-[3'-methyl-2-(1-methyl-1,2,4-triazole-3-carbonyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-4H-pyrazole]-1'-yl]ethanone;oxalic acid (PubChem CID 155870490) has the molecular formula C18H24N6O6 and a molecular weight of 420.43 g/mol. Its IUPAC name is 1-[3'-methyl-2-(1-methyl-1,2,4-triazole-3-carbonyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-4H-pyrazole]-1'-yl]ethanone;oxalic acid.
| Compound Name | 1-[3'-methyl-2-(1-methyl-1,2,4-triazole-3-carbonyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-4H-pyrazole]-1'-yl]ethanone;oxalic acid |
|---|---|
| PubChem CID | 155870490 |
| Molecular Formula | C18H24N6O6 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-[3'-methyl-2-(1-methyl-1,2,4-triazole-3-carbonyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-4H-pyrazole]-1'-yl]ethanone;oxalic acid |
| SMILES | CC(=O)N1N=C(C)CC12CCC1CN(C(=O)c3ncn(C)n3)CC12.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H22N6O2.C2H2O4/c1-10-6-16(22(18-10)11(2)23)5-4-12-7-21(8-13(12)16)15(24)14-17-9-20(3)19-14;3-1(4)2(5)6/h9,12-13H,4-8H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | AZVFKOVLAGGPIF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 158.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|