C18H17FN2O2 — CID 15587246
1-(3-fluorophenyl)-7,8-dimethoxy-4-methyl-5H-2,3-benzodiazepine (PubChem CID 15587246) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-7,8-dimethoxy-4-methyl-5H-2,3-benzodiazepine.
| Compound Name | 1-(3-fluorophenyl)-7,8-dimethoxy-4-methyl-5H-2,3-benzodiazepine |
|---|---|
| PubChem CID | 15587246 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-(3-fluorophenyl)-7,8-dimethoxy-4-methyl-5H-2,3-benzodiazepine |
| SMILES | COc1cc2c(cc1OC)C(c1cccc(F)c1)=NN=C(C)C2 |
| InChI | InChI=1S/C18H17FN2O2/c1-11-7-13-9-16(22-2)17(23-3)10-15(13)18(21-20-11)12-5-4-6-14(19)8-12/h4-6,8-10H,7H2,1-3H3 |
| InChIKey | NLWAZOPOYVPSLG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |