C16H16N2O2S — CID 15587287
7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine (PubChem CID 15587287) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine.
| Compound Name | 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine |
|---|---|
| PubChem CID | 15587287 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine |
| SMILES | COc1cc2c(cc1OC)C(c1cccs1)=NN=C(C)C2 |
| InChI | InChI=1S/C16H16N2O2S/c1-10-7-11-8-13(19-2)14(20-3)9-12(11)16(18-17-10)15-5-4-6-21-15/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | SNHOCWVLRJWZQI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |