About 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine
7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine (PubChem CID 15587287) has the molecular formula C16H16N2O2S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine.
Molecular Properties
| Compound Name | 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine |
| PubChem CID | 15587287 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine |
| SMILES | COc1cc2c(cc1OC)C(c1cccs1)=NN=C(C)C2 |
| InChI | InChI=1S/C16H16N2O2S/c1-10-7-11-8-13(19-2)14(20-3)9-12(11)16(18-17-10)15-5-4-6-21-15/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | SNHOCWVLRJWZQI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine?
The IUPAC name of 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine (CID 15587287) is 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine.
What is the SMILES notation for 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine?
The canonical SMILES for 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine is COc1cc2c(cc1OC)C(c1cccs1)=NN=C(C)C2.
What is the InChIKey of 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine?
The InChIKey is SNHOCWVLRJWZQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S/c1-10-7-11-8-13(19-2)14(20-3)9-12(11)16(18-17-10)15-5-4-6-21-15/h4-6,8-9H,7H2,1-3H3.
What are the key properties of 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine?
7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine has a molecular weight of 300.38 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5H-2,3-benzodiazepine is sourced from PubChem (CID 15587287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).