C18H24N6O — CID 155877038
[(3aS,8aR)-6-[(2-methylpyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-pyrimidin-5-ylmethanone (PubChem CID 155877038) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is [(3aS,8aR)-6-[(2-methylpyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-pyrimidin-5-ylmethanone.
| Compound Name | [(3aS,8aR)-6-[(2-methylpyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-pyrimidin-5-ylmethanone |
|---|---|
| PubChem CID | 155877038 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [(3aS,8aR)-6-[(2-methylpyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-pyrimidin-5-ylmethanone |
| SMILES | Cn1nccc1CN1CC[C@@H]2CN(C(=O)c3cncnc3)C[C@@H]2CC1 |
| InChI | InChI=1S/C18H24N6O/c1-22-17(2-5-21-22)12-23-6-3-14-10-24(11-15(14)4-7-23)18(25)16-8-19-13-20-9-16/h2,5,8-9,13-15H,3-4,6-7,10-12H2,1H3/t14-,15+ |
| InChIKey | GCEDLFCBOKVSQP-GASCZTMLSA-N |
| XLogP | 1.19 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |