C19H24FN5O — CID 155876927
[(3aR,8aS)-6-[(2-methylpyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(2-fluoro-4-pyridinyl)methanone (PubChem CID 155876927) has the molecular formula C19H24FN5O and a molecular weight of 357.43 g/mol. Its IUPAC name is [(3aR,8aS)-6-[(2-methylpyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(2-fluoro-4-pyridinyl)methanone.
| Compound Name | [(3aR,8aS)-6-[(2-methylpyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(2-fluoro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 155876927 |
| Molecular Formula | C19H24FN5O |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | [(3aR,8aS)-6-[(2-methylpyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(2-fluoro-4-pyridinyl)methanone |
| SMILES | Cn1nccc1CN1CC[C@@H]2CN(C(=O)c3ccnc(F)c3)C[C@@H]2CC1 |
| InChI | InChI=1S/C19H24FN5O/c1-23-17(3-7-22-23)13-24-8-4-15-11-25(12-16(15)5-9-24)19(26)14-2-6-21-18(20)10-14/h2-3,6-7,10,15-16H,4-5,8-9,11-13H2,1H3/t15-,16+ |
| InChIKey | STBFUIHGKXAAFZ-IYBDPMFKSA-N |
| XLogP | 1.94 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|