C15H20N6O — CID 155877615
(4aS,7aS)-6-[(5-methyl-1H-pyrazol-3-yl)methyl]-4-pyrazin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 155877615) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is (4aS,7aS)-6-[(5-methyl-1H-pyrazol-3-yl)methyl]-4-pyrazin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aS)-6-[(5-methyl-1H-pyrazol-3-yl)methyl]-4-pyrazin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 155877615 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (4aS,7aS)-6-[(5-methyl-1H-pyrazol-3-yl)methyl]-4-pyrazin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | Cc1cc(CN2C[C@@H]3OCCN(c4cnccn4)[C@H]3C2)n[nH]1 |
| InChI | InChI=1S/C15H20N6O/c1-11-6-12(19-18-11)8-20-9-13-14(10-20)22-5-4-21(13)15-7-16-2-3-17-15/h2-3,6-7,13-14H,4-5,8-10H2,1H3,(H,18,19)/t13-,14-/m0/s1 |
| InChIKey | JPVQJYWPGJEVRX-KBPBESRZSA-N |
| XLogP | 0.60 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |