C16H24N6O — CID 155878944
1-[(1-ethylpyrazol-4-yl)methyl]-N-methyl-3-pyrazol-1-ylpiperidine-3-carboxamide (PubChem CID 155878944) has the molecular formula C16H24N6O and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-[(1-ethylpyrazol-4-yl)methyl]-N-methyl-3-pyrazol-1-ylpiperidine-3-carboxamide.
| Compound Name | 1-[(1-ethylpyrazol-4-yl)methyl]-N-methyl-3-pyrazol-1-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 155878944 |
| Molecular Formula | C16H24N6O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 1-[(1-ethylpyrazol-4-yl)methyl]-N-methyl-3-pyrazol-1-ylpiperidine-3-carboxamide |
| SMILES | CCn1cc(CN2CCCC(C(=O)NC)(n3cccn3)C2)cn1 |
| InChI | InChI=1S/C16H24N6O/c1-3-21-12-14(10-19-21)11-20-8-4-6-16(13-20,15(23)17-2)22-9-5-7-18-22/h5,7,9-10,12H,3-4,6,8,11,13H2,1-2H3,(H,17,23) |
| InChIKey | UCNPDAYIPCAVAW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |