C16H20N4O2S — CID 155879673
N-methyl-3-pyrazol-1-yl-1-(2-thiophen-2-ylacetyl)piperidine-3-carboxamide (PubChem CID 155879673) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-methyl-3-pyrazol-1-yl-1-(2-thiophen-2-ylacetyl)piperidine-3-carboxamide.
| Compound Name | N-methyl-3-pyrazol-1-yl-1-(2-thiophen-2-ylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 155879673 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-methyl-3-pyrazol-1-yl-1-(2-thiophen-2-ylacetyl)piperidine-3-carboxamide |
| SMILES | CNC(=O)C1(n2cccn2)CCCN(C(=O)Cc2cccs2)C1 |
| InChI | InChI=1S/C16H20N4O2S/c1-17-15(22)16(20-9-4-7-18-20)6-3-8-19(12-16)14(21)11-13-5-2-10-23-13/h2,4-5,7,9-10H,3,6,8,11-12H2,1H3,(H,17,22) |
| InChIKey | UVVPJNKZYKPGNR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |