C19H26N4O5S — CID 155879962
azetidin-1-yl-[4-pyrazol-1-yl-1-(thiophen-2-ylmethyl)piperidin-4-yl]methanone;formic acid (PubChem CID 155879962) has the molecular formula C19H26N4O5S and a molecular weight of 422.51 g/mol. Its IUPAC name is azetidin-1-yl-[4-pyrazol-1-yl-1-(thiophen-2-ylmethyl)piperidin-4-yl]methanone;formic acid.
| Compound Name | azetidin-1-yl-[4-pyrazol-1-yl-1-(thiophen-2-ylmethyl)piperidin-4-yl]methanone;formic acid |
|---|---|
| PubChem CID | 155879962 |
| Molecular Formula | C19H26N4O5S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | azetidin-1-yl-[4-pyrazol-1-yl-1-(thiophen-2-ylmethyl)piperidin-4-yl]methanone;formic acid |
| SMILES | O=C(N1CCC1)C1(n2cccn2)CCN(Cc2cccs2)CC1.O=CO.O=CO |
| InChI | InChI=1S/C17H22N4OS.2CH2O2/c22-16(20-8-3-9-20)17(21-10-2-7-18-21)5-11-19(12-6-17)14-15-4-1-13-23-15;2*2-1-3/h1-2,4,7,10,13H,3,5-6,8-9,11-12,14H2;2*1H,(H,2,3) |
| InChIKey | OBHJDPPGMHQMCI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|