C18H19N3O3S — CID 70726800
4-[3-(furan-2-yl)pyrazol-1-yl]-1-(thiophen-2-ylmethyl)piperidine-4-carboxylic acid (PubChem CID 70726800) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 4-[3-(furan-2-yl)pyrazol-1-yl]-1-(thiophen-2-ylmethyl)piperidine-4-carboxylic acid.
| Compound Name | 4-[3-(furan-2-yl)pyrazol-1-yl]-1-(thiophen-2-ylmethyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 70726800 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 4-[3-(furan-2-yl)pyrazol-1-yl]-1-(thiophen-2-ylmethyl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(n2ccc(-c3ccco3)n2)CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C18H19N3O3S/c22-17(23)18(21-8-5-15(19-21)16-4-1-11-24-16)6-9-20(10-7-18)13-14-3-2-12-25-14/h1-5,8,11-12H,6-7,9-10,13H2,(H,22,23) |
| InChIKey | SSMJAYRIWPOBNK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |